Boc-L-Thr(Bzl)-O-CH2-Ph-CH2-COOH·DCHA

Boc-L-Thr(Bzl)-O-CH2-Ph-CH2-COOH·DCHA is widely utilized in research focused on:

Peptide Synthesis: This compound serves as a valuable building block in the synthesis of peptides, which are essential in drug development and biochemistry. Its protective group allows for selective reactions, enhancing the efficiency of peptide assembly.

Drug Development: The compound's unique structure can be modified to create novel therapeutic agents. Its application in medicinal chemistry helps researchers design drugs that target specific biological pathways.

Bioconjugation: It can be used in bioconjugation processes, linking biomolecules to other entities, such as drugs or imaging agents, which is crucial in targeted therapy and diagnostics.

Research in Neuroscience: Due to its potential to influence neurotransmitter systems, it is explored in neuroscience research for developing treatments for neurological disorders.

Cosmetic Formulations: The compound's properties make it suitable for use in cosmetic formulations, particularly in anti-aging products, where it can enhance skin penetration and efficacy of active ingredients.