Product Name
Z-L-glutamic acid
Certificate of Analysis (COA)
IUPAC Name
(2S)-2-(phenylmethoxycarbonylamino)pentanedioic acid
InChI Key
PVFCXMDXBIEMQG-JTQLQIEISA-N
SMILES
C1=CC=C(C=C1)COC(=O)NC@@H(CCC(=O)O)C(=O)O
Z-L-glutamic acid is widely utilized in research focused on:
Biotechnology: It serves as a building block in peptide synthesis, crucial for developing new biopharmaceuticals and therapeutic proteins.
Food Industry: Used as a flavor enhancer, it contributes to umami taste, making it popular in various food products.
Neuroscience: This compound plays a role in neurotransmission studies, helping researchers understand brain function and potential treatments for neurological disorders.
Agriculture: It is applied in developing fertilizers that enhance plant growth and resistance to stress, benefiting crop yields.
Cosmetics: Incorporated into skincare formulations, it helps improve skin hydration and elasticity, appealing to the beauty industry.