Product Name
5,5'-Dithiobis(2-nitrobenzoic acid), 99%
Molecular Formula
C14H8N2O8S2
Certificate of Analysis (COA)
IUPAC Name
5-(3-carboxy-4-nitrophenyl)disulfanyl-2-nitrobenzoic acid
InChI Key
KIUMMUBSPKGMOY-UHFFFAOYSA-N
SMILES
C1=CC(=C(C=C1SSC2=CC(=C(C=C2)N+(=O)O-)C(=O)O)C(=O)O)N+(=O)O-
5,5'-Dithiobis(2-nitrobenzoic acid) is widely utilized in research focused on:
Biochemical Assays: This compound is commonly used as a reagent in biochemical assays to measure thiol concentrations, helping researchers understand cellular redox states.
Protein Labeling: It serves as a labeling agent for proteins, allowing scientists to track and study protein interactions and functions in various biological systems.
Drug Development: In pharmaceutical research, it aids in the development of drugs targeting oxidative stress-related diseases by providing insights into thiol-disulfide exchange reactions.
Environmental Monitoring: The compound is utilized in environmental chemistry to detect and quantify thiol compounds in samples, which is crucial for assessing pollution levels.
Analytical Chemistry: It plays a role in analytical methods for the detection of heavy metals, enhancing the sensitivity and specificity of tests in various industrial applications.