Boc-L-Ser(Bzl)-O-CH2-Ph-CH2-COOH·DCHA

Boc-L-Ser(Bzl)-O-CH2-Ph-CH2-COOH·DCHA is widely utilized in research focused on

Peptide Synthesis: This compound serves as a key building block in the synthesis of peptides, which are essential for developing new drugs and therapeutic agents.

Drug Development: Its unique structure allows for modifications that can enhance the efficacy and specificity of pharmaceutical compounds, making it valuable in the pharmaceutical industry.

Bioconjugation: The compound can be used in bioconjugation processes to attach biomolecules to surfaces or other molecules, facilitating targeted drug delivery systems.

Research in Neuroscience: It is employed in studies related to neurotransmitter functions, helping researchers understand neurological pathways and potential treatments for disorders.

Cosmetic Formulations: The compound's properties make it suitable for use in cosmetic products, particularly in formulations aimed at skin hydration and repair.